C16H26O3 — CID 67947027
[6-(cyclohexen-1-yl)-4,5-dimethyl-6-oxohexyl] acetate (PubChem CID 67947027) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is [6-(cyclohexen-1-yl)-4,5-dimethyl-6-oxohexyl] acetate.
| Compound Name | [6-(cyclohexen-1-yl)-4,5-dimethyl-6-oxohexyl] acetate |
|---|---|
| PubChem CID | 67947027 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | [6-(cyclohexen-1-yl)-4,5-dimethyl-6-oxohexyl] acetate |
| SMILES | CC(=O)OCCCC(C)C(C)C(=O)C1=CCCCC1 |
| InChI | InChI=1S/C16H26O3/c1-12(8-7-11-19-14(3)17)13(2)16(18)15-9-5-4-6-10-15/h9,12-13H,4-8,10-11H2,1-3H3 |
| InChIKey | ISRSQHQASFGFSS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|