C10H12N2O2 — CID 67951284
5-(6-amino-3-pyridinyl)pent-4-yne-1,2-diol (PubChem CID 67951284) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 5-(6-amino-3-pyridinyl)pent-4-yne-1,2-diol.
| Compound Name | 5-(6-amino-3-pyridinyl)pent-4-yne-1,2-diol |
|---|---|
| PubChem CID | 67951284 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 5-(6-amino-3-pyridinyl)pent-4-yne-1,2-diol |
| SMILES | Nc1ccc(C#CCC(O)CO)cn1 |
| InChI | InChI=1S/C10H12N2O2/c11-10-5-4-8(6-12-10)2-1-3-9(14)7-13/h4-6,9,13-14H,3,7H2,(H2,11,12) |
| InChIKey | UYHGFOKSZGHMJW-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|