C12H15FN4O4 — CID 67957701
2-(4-fluoropiperidin-1-yl)-6-(methylamino)-5-nitropyridine-3-carboxylic acid (PubChem CID 67957701) has the molecular formula C12H15FN4O4 and a molecular weight of 298.27 g/mol. Its IUPAC name is 2-(4-fluoropiperidin-1-yl)-6-(methylamino)-5-nitropyridine-3-carboxylic acid.
| Compound Name | 2-(4-fluoropiperidin-1-yl)-6-(methylamino)-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67957701 |
| Molecular Formula | C12H15FN4O4 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(4-fluoropiperidin-1-yl)-6-(methylamino)-5-nitropyridine-3-carboxylic acid |
| SMILES | CNc1nc(N2CCC(F)CC2)c(C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15FN4O4/c1-14-10-9(17(20)21)6-8(12(18)19)11(15-10)16-4-2-7(13)3-5-16/h6-7H,2-5H2,1H3,(H,14,15)(H,18,19) |
| InChIKey | ULMHDJASBITJHG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|