C20H24F6N4O4 — CID 123533202
6-[methyl-[4-(trifluoromethyl)cyclohexyl]amino]-5-nitro-2-[4-(trifluoromethyl)piperidin-1-yl]pyridine-3-carboxylic acid (PubChem CID 123533202) has the molecular formula C20H24F6N4O4 and a molecular weight of 498.42 g/mol. Its IUPAC name is 6-[methyl-[4-(trifluoromethyl)cyclohexyl]amino]-5-nitro-2-[4-(trifluoromethyl)piperidin-1-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-[methyl-[4-(trifluoromethyl)cyclohexyl]amino]-5-nitro-2-[4-(trifluoromethyl)piperidin-1-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 123533202 |
| Molecular Formula | C20H24F6N4O4 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 6-[methyl-[4-(trifluoromethyl)cyclohexyl]amino]-5-nitro-2-[4-(trifluoromethyl)piperidin-1-yl]pyridine-3-carboxylic acid |
| SMILES | CN(c1nc(N2CCC(C(F)(F)F)CC2)c(C(=O)O)cc1[N+](=O)[O-])C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H24F6N4O4/c1-28(13-4-2-11(3-5-13)19(21,22)23)17-15(30(33)34)10-14(18(31)32)16(27-17)29-8-6-12(7-9-29)20(24,25)26/h10-13H,2-9H2,1H3,(H,31,32) |
| InChIKey | QGZDUXJZRMWEEF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|