C17H14ClF3N2O3 — CID 67958118
5-chloro-2-[3-[3-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]pyridine-3-carboxylic acid (PubChem CID 67958118) has the molecular formula C17H14ClF3N2O3 and a molecular weight of 386.76 g/mol. Its IUPAC name is 5-chloro-2-[3-[3-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-2-[3-[3-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67958118 |
| Molecular Formula | C17H14ClF3N2O3 |
| Molecular Weight | 386.76 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 5-chloro-2-[3-[3-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)cnc1N1CCC(Oc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C17H14ClF3N2O3/c18-11-7-14(16(24)25)15(22-8-11)23-5-4-13(9-23)26-12-3-1-2-10(6-12)17(19,20)21/h1-3,6-8,13H,4-5,9H2,(H,24,25) |
| InChIKey | YVZLUWMZTJPLJO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |