C20H21Cl2N3O3 — CID 133406453
[5-chloro-6-[3-(3-chlorophenoxy)pyrrolidin-1-yl]-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 133406453) has the molecular formula C20H21Cl2N3O3 and a molecular weight of 422.31 g/mol. Its IUPAC name is [5-chloro-6-[3-(3-chlorophenoxy)pyrrolidin-1-yl]-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [5-chloro-6-[3-(3-chlorophenoxy)pyrrolidin-1-yl]-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133406453 |
| Molecular Formula | C20H21Cl2N3O3 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | [5-chloro-6-[3-(3-chlorophenoxy)pyrrolidin-1-yl]-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cnc(N2CCC(Oc3cccc(Cl)c3)C2)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C20H21Cl2N3O3/c21-15-2-1-3-16(11-15)28-17-4-5-25(13-17)19-18(22)10-14(12-23-19)20(26)24-6-8-27-9-7-24/h1-3,10-12,17H,4-9,13H2 |
| InChIKey | PZZKVZRMOMSSMI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |