C20H22ClFN4O2 — CID 10319071
[5-chloro-6-[4-[(6-fluoro-2-pyridinyl)oxy]piperidin-1-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone (PubChem CID 10319071) has the molecular formula C20H22ClFN4O2 and a molecular weight of 404.87 g/mol. Its IUPAC name is [5-chloro-6-[4-[(6-fluoro-2-pyridinyl)oxy]piperidin-1-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-chloro-6-[4-[(6-fluoro-2-pyridinyl)oxy]piperidin-1-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 10319071 |
| Molecular Formula | C20H22ClFN4O2 |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [5-chloro-6-[4-[(6-fluoro-2-pyridinyl)oxy]piperidin-1-yl]-3-pyridinyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cnc(N2CCC(Oc3cccc(F)n3)CC2)c(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C20H22ClFN4O2/c21-16-12-14(20(27)26-8-1-2-9-26)13-23-19(16)25-10-6-15(7-11-25)28-18-5-3-4-17(22)24-18/h3-5,12-13,15H,1-2,6-11H2 |
| InChIKey | IIDWQRINIMMSKF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|