C22H22N6O2 — CID 67960019
5-(6-methoxy-2-pyridinyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole (PubChem CID 67960019) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 5-(6-methoxy-2-pyridinyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole.
| Compound Name | 5-(6-methoxy-2-pyridinyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole |
|---|---|
| PubChem CID | 67960019 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 5-(6-methoxy-2-pyridinyl)-3-(6-piperidin-3-yloxypyrazin-2-yl)-1H-indazole |
| SMILES | COc1cccc(-c2ccc3[nH]nc(-c4cncc(OC5CCCNC5)n4)c3c2)n1 |
| InChI | InChI=1S/C22H22N6O2/c1-29-20-6-2-5-17(25-20)14-7-8-18-16(10-14)22(28-27-18)19-12-24-13-21(26-19)30-15-4-3-9-23-11-15/h2,5-8,10,12-13,15,23H,3-4,9,11H2,1H3,(H,27,28) |
| InChIKey | DKQKTEKAIQIKBY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |