C20H19N7O — CID 67960106
3-(6-piperidin-3-yloxypyrazin-2-yl)-5-pyridazin-3-yl-1H-indazole (PubChem CID 67960106) has the molecular formula C20H19N7O and a molecular weight of 373.42 g/mol. Its IUPAC name is 3-(6-piperidin-3-yloxypyrazin-2-yl)-5-pyridazin-3-yl-1H-indazole.
| Compound Name | 3-(6-piperidin-3-yloxypyrazin-2-yl)-5-pyridazin-3-yl-1H-indazole |
|---|---|
| PubChem CID | 67960106 |
| Molecular Formula | C20H19N7O |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-(6-piperidin-3-yloxypyrazin-2-yl)-5-pyridazin-3-yl-1H-indazole |
| SMILES | c1cnnc(-c2ccc3[nH]nc(-c4cncc(OC5CCCNC5)n4)c3c2)c1 |
| InChI | InChI=1S/C20H19N7O/c1-3-14(10-21-7-1)28-19-12-22-11-18(24-19)20-15-9-13(5-6-17(15)26-27-20)16-4-2-8-23-25-16/h2,4-6,8-9,11-12,14,21H,1,3,7,10H2,(H,26,27) |
| InChIKey | VYSPQJLIBHYCAH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |