C19H18N4OS2 — CID 164883551
5-[[3-(6-piperidin-3-yloxypyrazin-2-yl)phenyl]methylidene]-1,3-thiazole-2-thione (PubChem CID 164883551) has the molecular formula C19H18N4OS2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 5-[[3-(6-piperidin-3-yloxypyrazin-2-yl)phenyl]methylidene]-1,3-thiazole-2-thione.
| Compound Name | 5-[[3-(6-piperidin-3-yloxypyrazin-2-yl)phenyl]methylidene]-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 164883551 |
| Molecular Formula | C19H18N4OS2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 5-[[3-(6-piperidin-3-yloxypyrazin-2-yl)phenyl]methylidene]-1,3-thiazole-2-thione |
| SMILES | S=C1N=CC(=Cc2cccc(-c3cncc(OC4CCCNC4)n3)c2)S1 |
| InChI | InChI=1S/C19H18N4OS2/c25-19-22-10-16(26-19)8-13-3-1-4-14(7-13)17-11-21-12-18(23-17)24-15-5-2-6-20-9-15/h1,3-4,7-8,10-12,15,20H,2,5-6,9H2 |
| InChIKey | BVUMNUZZAKAABE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|