C22H31N2OP — CID 67960735
(2S)-N-diphenylphosphoryl-3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-amine (PubChem CID 67960735) has the molecular formula C22H31N2OP and a molecular weight of 370.48 g/mol. Its IUPAC name is (2S)-N-diphenylphosphoryl-3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-amine.
| Compound Name | (2S)-N-diphenylphosphoryl-3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-amine |
|---|---|
| PubChem CID | 67960735 |
| Molecular Formula | C22H31N2OP |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (2S)-N-diphenylphosphoryl-3,3-dimethyl-1-pyrrolidin-1-ylbutan-2-amine |
| SMILES | CC(C)(C)[C@@H](CN1CCCC1)NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H31N2OP/c1-22(2,3)21(18-24-16-10-11-17-24)23-26(25,19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-9,12-15,21H,10-11,16-18H2,1-3H3,(H,23,25)/t21-/m1/s1 |
| InChIKey | LMNCFMRWOOLDJD-OAQYLSRUSA-N |
| XLogP | 4.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|