C17H9ClF3NO2 — CID 67961034
methyl 8-chloro-4-(2,4,6-trifluorophenyl)quinoline-6-carboxylate (PubChem CID 67961034) has the molecular formula C17H9ClF3NO2 and a molecular weight of 351.71 g/mol. Its IUPAC name is methyl 8-chloro-4-(2,4,6-trifluorophenyl)quinoline-6-carboxylate.
| Compound Name | methyl 8-chloro-4-(2,4,6-trifluorophenyl)quinoline-6-carboxylate |
|---|---|
| PubChem CID | 67961034 |
| Molecular Formula | C17H9ClF3NO2 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | methyl 8-chloro-4-(2,4,6-trifluorophenyl)quinoline-6-carboxylate |
| SMILES | COC(=O)c1cc(Cl)c2nccc(-c3c(F)cc(F)cc3F)c2c1 |
| InChI | InChI=1S/C17H9ClF3NO2/c1-24-17(23)8-4-11-10(2-3-22-16(11)12(18)5-8)15-13(20)6-9(19)7-14(15)21/h2-7H,1H3 |
| InChIKey | VNVSLOAJYROBOY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |