C17H20N6O2 — CID 679638
7-benzyl-3-methyl-8-piperazin-1-ylpurine-2,6-dione (PubChem CID 679638) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 7-benzyl-3-methyl-8-piperazin-1-ylpurine-2,6-dione.
| Compound Name | 7-benzyl-3-methyl-8-piperazin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 679638 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 7-benzyl-3-methyl-8-piperazin-1-ylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCNCC1)n2Cc1ccccc1 |
| InChI | InChI=1S/C17H20N6O2/c1-21-14-13(15(24)20-17(21)25)23(11-12-5-3-2-4-6-12)16(19-14)22-9-7-18-8-10-22/h2-6,18H,7-11H2,1H3,(H,20,24,25) |
| InChIKey | OSWQQKHGTFZUND-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |