C18H19ClFN3O2 — CID 67969231
5-chloro-4-[2-fluoro-5-(oxan-4-ylmethylamino)phenyl]pyridine-2-carboxamide (PubChem CID 67969231) has the molecular formula C18H19ClFN3O2 and a molecular weight of 363.82 g/mol. Its IUPAC name is 5-chloro-4-[2-fluoro-5-(oxan-4-ylmethylamino)phenyl]pyridine-2-carboxamide.
| Compound Name | 5-chloro-4-[2-fluoro-5-(oxan-4-ylmethylamino)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 67969231 |
| Molecular Formula | C18H19ClFN3O2 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 5-chloro-4-[2-fluoro-5-(oxan-4-ylmethylamino)phenyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2cc(NCC3CCOCC3)ccc2F)c(Cl)cn1 |
| InChI | InChI=1S/C18H19ClFN3O2/c19-15-10-23-17(18(21)24)8-13(15)14-7-12(1-2-16(14)20)22-9-11-3-5-25-6-4-11/h1-2,7-8,10-11,22H,3-6,9H2,(H2,21,24) |
| InChIKey | HZKSWCICDPWHKL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |