C17H18F3N5O2 — CID 67980208
4-[6-(oxan-4-ylmethylamino)pyrazin-2-yl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 67980208) has the molecular formula C17H18F3N5O2 and a molecular weight of 381.36 g/mol. Its IUPAC name is 4-[6-(oxan-4-ylmethylamino)pyrazin-2-yl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | 4-[6-(oxan-4-ylmethylamino)pyrazin-2-yl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 67980208 |
| Molecular Formula | C17H18F3N5O2 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-[6-(oxan-4-ylmethylamino)pyrazin-2-yl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2cncc(NCC3CCOCC3)n2)c(C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H18F3N5O2/c18-17(19,20)12-7-23-13(16(21)26)5-11(12)14-8-22-9-15(25-14)24-6-10-1-3-27-4-2-10/h5,7-10H,1-4,6H2,(H2,21,26)(H,24,25) |
| InChIKey | YJTXAZKPUNLIRL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |