C23H21Cl3N4O2 — CID 67970814
4-[(2,4-dichlorophenyl)methoxy]-1-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)pyridin-2-one;hydrochloride (PubChem CID 67970814) has the molecular formula C23H21Cl3N4O2 and a molecular weight of 491.81 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methoxy]-1-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)pyridin-2-one;hydrochloride.
| Compound Name | 4-[(2,4-dichlorophenyl)methoxy]-1-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 67970814 |
| Molecular Formula | C23H21Cl3N4O2 |
| Molecular Weight | 491.81 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methoxy]-1-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)pyridin-2-one;hydrochloride |
| SMILES | Cl.Cn1c2c(c3ccc(-n4ccc(OCc5ccc(Cl)cc5Cl)cc4=O)nc31)CNCC2 |
| InChI | InChI=1S/C23H20Cl2N4O2.ClH/c1-28-20-6-8-26-12-18(20)17-4-5-21(27-23(17)28)29-9-7-16(11-22(29)30)31-13-14-2-3-15(24)10-19(14)25;/h2-5,7,9-11,26H,6,8,12-13H2,1H3;1H |
| InChIKey | RBMLFVAVVXLQPY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.81 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |