C23H23N5O — CID 70805179
4-(5-methyl-2-pyridinyl)-1-(8-methyl-6,8,13-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one (PubChem CID 70805179) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-(5-methyl-2-pyridinyl)-1-(8-methyl-6,8,13-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one.
| Compound Name | 4-(5-methyl-2-pyridinyl)-1-(8-methyl-6,8,13-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one |
|---|---|
| PubChem CID | 70805179 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 4-(5-methyl-2-pyridinyl)-1-(8-methyl-6,8,13-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one |
| SMILES | Cc1ccc(-c2ccn(-c3ccc4c5c(n(C)c4n3)CCCNC5)c(=O)c2)nc1 |
| InChI | InChI=1S/C23H23N5O/c1-15-5-7-19(25-13-15)16-9-11-28(22(29)12-16)21-8-6-17-18-14-24-10-3-4-20(18)27(2)23(17)26-21/h5-9,11-13,24H,3-4,10,14H2,1-2H3 |
| InChIKey | ARZYKPOLFCOOCN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |