C25H23F3N4O — CID 163425163
1-(10-ethyl-2,3,4,5-tetrahydro-1H-azepino[3,4-b]indol-8-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one (PubChem CID 163425163) has the molecular formula C25H23F3N4O and a molecular weight of 452.48 g/mol. Its IUPAC name is 1-(10-ethyl-2,3,4,5-tetrahydro-1H-azepino[3,4-b]indol-8-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one.
| Compound Name | 1-(10-ethyl-2,3,4,5-tetrahydro-1H-azepino[3,4-b]indol-8-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one |
|---|---|
| PubChem CID | 163425163 |
| Molecular Formula | C25H23F3N4O |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 1-(10-ethyl-2,3,4,5-tetrahydro-1H-azepino[3,4-b]indol-8-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one |
| SMILES | CCn1c2c(c3ccc(-n4ccc(-c5ccc(C(F)(F)F)cn5)cc4=O)cc31)CCCNC2 |
| InChI | InChI=1S/C25H23F3N4O/c1-2-31-22-13-18(6-7-20(22)19-4-3-10-29-15-23(19)31)32-11-9-16(12-24(32)33)21-8-5-17(14-30-21)25(26,27)28/h5-9,11-14,29H,2-4,10,15H2,1H3 |
| InChIKey | ALVYZHUHEWZCBQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|