C23H21F3N4O — CID 70823061
1-(9-methyl-1,2,3,4,4a,9a-hexahydropyrido[3,4-b]indol-7-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one (PubChem CID 70823061) has the molecular formula C23H21F3N4O and a molecular weight of 426.44 g/mol. Its IUPAC name is 1-(9-methyl-1,2,3,4,4a,9a-hexahydropyrido[3,4-b]indol-7-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one.
| Compound Name | 1-(9-methyl-1,2,3,4,4a,9a-hexahydropyrido[3,4-b]indol-7-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one |
|---|---|
| PubChem CID | 70823061 |
| Molecular Formula | C23H21F3N4O |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 1-(9-methyl-1,2,3,4,4a,9a-hexahydropyrido[3,4-b]indol-7-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one |
| SMILES | CN1c2cc(-n3ccc(-c4ccc(C(F)(F)F)cn4)cc3=O)ccc2C2CCNCC21 |
| InChI | InChI=1S/C23H21F3N4O/c1-29-20-11-16(3-4-17(20)18-6-8-27-13-21(18)29)30-9-7-14(10-22(30)31)19-5-2-15(12-28-19)23(24,25)26/h2-5,7,9-12,18,21,27H,6,8,13H2,1H3 |
| InChIKey | CRJNVZKHSXCUDV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |