C24H23F3N4O2 — CID 70823052
1-(5-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-7-yl)-4-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]pyridin-2-one (PubChem CID 70823052) has the molecular formula C24H23F3N4O2 and a molecular weight of 456.47 g/mol. Its IUPAC name is 1-(5-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-7-yl)-4-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]pyridin-2-one.
| Compound Name | 1-(5-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-7-yl)-4-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]pyridin-2-one |
|---|---|
| PubChem CID | 70823052 |
| Molecular Formula | C24H23F3N4O2 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 1-(5-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-7-yl)-4-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]pyridin-2-one |
| SMILES | CN1c2cc(-n3ccc(OCc4ccc(C(F)(F)F)nc4)cc3=O)ccc2C2CNCCC21 |
| InChI | InChI=1S/C24H23F3N4O2/c1-30-20-6-8-28-13-19(20)18-4-3-16(10-21(18)30)31-9-7-17(11-23(31)32)33-14-15-2-5-22(29-12-15)24(25,26)27/h2-5,7,9-12,19-20,28H,6,8,13-14H2,1H3 |
| InChIKey | XUCRLCRDQZGGAA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |