C17H21F3N2O — CID 58700358
(4aS,9bR)-8-(cyclopropylmethoxy)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole (PubChem CID 58700358) has the molecular formula C17H21F3N2O and a molecular weight of 326.36 g/mol. Its IUPAC name is (4aS,9bR)-8-(cyclopropylmethoxy)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | (4aS,9bR)-8-(cyclopropylmethoxy)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 58700358 |
| Molecular Formula | C17H21F3N2O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (4aS,9bR)-8-(cyclopropylmethoxy)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
| SMILES | CN1c2c(cc(OCC3CC3)cc2C(F)(F)F)[C@@H]2CNCC[C@@H]21 |
| InChI | InChI=1S/C17H21F3N2O/c1-22-15-4-5-21-8-13(15)12-6-11(23-9-10-2-3-10)7-14(16(12)22)17(18,19)20/h6-7,10,13,15,21H,2-5,8-9H2,1H3/t13-,15-/m0/s1 |
| InChIKey | YBIBPSIPZHYYKC-ZFWWWQNUSA-N |
| XLogP | 3.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|