C18H18ClF3N4 — CID 21056600
(4aS,9bR)-N-(6-chloro-3-pyridinyl)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-amine (PubChem CID 21056600) has the molecular formula C18H18ClF3N4 and a molecular weight of 382.82 g/mol. Its IUPAC name is (4aS,9bR)-N-(6-chloro-3-pyridinyl)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-amine.
| Compound Name | (4aS,9bR)-N-(6-chloro-3-pyridinyl)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-amine |
|---|---|
| PubChem CID | 21056600 |
| Molecular Formula | C18H18ClF3N4 |
| Molecular Weight | 382.82 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (4aS,9bR)-N-(6-chloro-3-pyridinyl)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-amine |
| SMILES | CN1c2c(cc(Nc3ccc(Cl)nc3)cc2C(F)(F)F)[C@@H]2CNCC[C@@H]21 |
| InChI | InChI=1S/C18H18ClF3N4/c1-26-15-4-5-23-9-13(15)12-6-11(7-14(17(12)26)18(20,21)22)25-10-2-3-16(19)24-8-10/h2-3,6-8,13,15,23,25H,4-5,9H2,1H3/t13-,15-/m0/s1 |
| InChIKey | XEXQHUDHWWXMEB-ZFWWWQNUSA-N |
| XLogP | 4.39 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|