C16H21F3N2 — CID 58700315
(4aS,9bR)-5-methyl-8-propyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole (PubChem CID 58700315) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (4aS,9bR)-5-methyl-8-propyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | (4aS,9bR)-5-methyl-8-propyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 58700315 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (4aS,9bR)-5-methyl-8-propyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
| SMILES | CCCc1cc2c(c(C(F)(F)F)c1)N(C)[C@H]1CCNC[C@@H]21 |
| InChI | InChI=1S/C16H21F3N2/c1-3-4-10-7-11-12-9-20-6-5-14(12)21(2)15(11)13(8-10)16(17,18)19/h7-8,12,14,20H,3-6,9H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | QAGIIWIXWMYGDZ-JSGCOSHPSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |