C20H22F3N3O — CID 142913578
(9bR)-N-(2-methoxyphenyl)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-amine (PubChem CID 142913578) has the molecular formula C20H22F3N3O and a molecular weight of 377.41 g/mol. Its IUPAC name is (9bR)-N-(2-methoxyphenyl)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-amine.
| Compound Name | (9bR)-N-(2-methoxyphenyl)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-amine |
|---|---|
| PubChem CID | 142913578 |
| Molecular Formula | C20H22F3N3O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (9bR)-N-(2-methoxyphenyl)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-8-amine |
| SMILES | COc1ccccc1Nc1cc2c(c(C(F)(F)F)c1)N(C)C1CCNC[C@@H]21 |
| InChI | InChI=1S/C20H22F3N3O/c1-26-17-7-8-24-11-14(17)13-9-12(10-15(19(13)26)20(21,22)23)25-16-5-3-4-6-18(16)27-2/h3-6,9-10,14,17,24-25H,7-8,11H2,1-2H3/t14-,17?/m0/s1 |
| InChIKey | ZOSDLERMYNBDMJ-MBIQTGHCSA-N |
| XLogP | 4.35 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |