C19H27F3N2O — CID 21056677
(4aR,9bS)-8-(3,3-dimethylbutoxy)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole (PubChem CID 21056677) has the molecular formula C19H27F3N2O and a molecular weight of 356.43 g/mol. Its IUPAC name is (4aR,9bS)-8-(3,3-dimethylbutoxy)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | (4aR,9bS)-8-(3,3-dimethylbutoxy)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 21056677 |
| Molecular Formula | C19H27F3N2O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (4aR,9bS)-8-(3,3-dimethylbutoxy)-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
| SMILES | CN1c2c(cc(OCCC(C)(C)C)cc2C(F)(F)F)[C@H]2CNCC[C@H]21 |
| InChI | InChI=1S/C19H27F3N2O/c1-18(2,3)6-8-25-12-9-13-14-11-23-7-5-16(14)24(4)17(13)15(10-12)19(20,21)22/h9-10,14,16,23H,5-8,11H2,1-4H3/t14-,16-/m1/s1 |
| InChIKey | IIRRQZZRBQSPOC-GDBMZVCRSA-N |
| XLogP | 4.42 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|