C20H21F3N2 — CID 21056683
(4aR,9bS)-8-benzyl-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole (PubChem CID 21056683) has the molecular formula C20H21F3N2 and a molecular weight of 346.40 g/mol. Its IUPAC name is (4aR,9bS)-8-benzyl-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | (4aR,9bS)-8-benzyl-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 21056683 |
| Molecular Formula | C20H21F3N2 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (4aR,9bS)-8-benzyl-5-methyl-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
| SMILES | CN1c2c(cc(Cc3ccccc3)cc2C(F)(F)F)[C@H]2CNCC[C@H]21 |
| InChI | InChI=1S/C20H21F3N2/c1-25-18-7-8-24-12-16(18)15-10-14(9-13-5-3-2-4-6-13)11-17(19(15)25)20(21,22)23/h2-6,10-11,16,18,24H,7-9,12H2,1H3/t16-,18-/m1/s1 |
| InChIKey | KJWQVNQPZZGDSB-SJLPKXTDSA-N |
| XLogP | 4.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |