C27H25F3N4O2 — CID 50903234
1-(9-methyl-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-6-yl)-4-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]pyridin-2-one (PubChem CID 50903234) has the molecular formula C27H25F3N4O2 and a molecular weight of 494.52 g/mol. Its IUPAC name is 1-(9-methyl-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-6-yl)-4-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]pyridin-2-one.
| Compound Name | 1-(9-methyl-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-6-yl)-4-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]pyridin-2-one |
|---|---|
| PubChem CID | 50903234 |
| Molecular Formula | C27H25F3N4O2 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 1-(9-methyl-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-6-yl)-4-[[6-(trifluoromethyl)-3-pyridinyl]methoxy]pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(OCc5ccc(C(F)(F)F)nc5)cc4=O)cc31)C1CCCC(C2)N1 |
| InChI | InChI=1S/C27H25F3N4O2/c1-33-22-12-18(6-7-20(22)26-21-4-2-3-17(32-21)11-23(26)33)34-10-9-19(13-25(34)35)36-15-16-5-8-24(31-14-16)27(28,29)30/h5-10,12-14,17,21,32H,2-4,11,15H2,1H3 |
| InChIKey | CTRBOXURFRHTEY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|