C24H20F3N3O — CID 70823054
1-(9-methyl-5,6,7,8-tetrahydrocarbazol-2-yl)-4-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-one (PubChem CID 70823054) has the molecular formula C24H20F3N3O and a molecular weight of 423.44 g/mol. Its IUPAC name is 1-(9-methyl-5,6,7,8-tetrahydrocarbazol-2-yl)-4-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-one.
| Compound Name | 1-(9-methyl-5,6,7,8-tetrahydrocarbazol-2-yl)-4-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-one |
|---|---|
| PubChem CID | 70823054 |
| Molecular Formula | C24H20F3N3O |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 1-(9-methyl-5,6,7,8-tetrahydrocarbazol-2-yl)-4-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(-c5ccc(C(F)(F)F)nc5)cc4=O)cc31)CCCC2 |
| InChI | InChI=1S/C24H20F3N3O/c1-29-20-5-3-2-4-18(20)19-8-7-17(13-21(19)29)30-11-10-15(12-23(30)31)16-6-9-22(28-14-16)24(25,26)27/h6-14H,2-5H2,1H3 |
| InChIKey | BYJICGZKJDWTSA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|