C25H22F3IN4O — CID 158657887
1-[5-ethyl-2-(iodomethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-one (PubChem CID 158657887) has the molecular formula C25H22F3IN4O and a molecular weight of 578.38 g/mol. Its IUPAC name is 1-[5-ethyl-2-(iodomethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-one.
| Compound Name | 1-[5-ethyl-2-(iodomethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-one |
|---|---|
| PubChem CID | 158657887 |
| Molecular Formula | C25H22F3IN4O |
| Molecular Weight | 578.38 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | 1-[5-ethyl-2-(iodomethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl]-4-[6-(trifluoromethyl)-3-pyridinyl]pyridin-2-one |
| SMILES | CCn1c2c(c3ccc(-n4ccc(-c5ccc(C(F)(F)F)nc5)cc4=O)cc31)CN(CI)CC2 |
| InChI | InChI=1S/C25H22F3IN4O/c1-2-32-21-8-9-31(15-29)14-20(21)19-5-4-18(12-22(19)32)33-10-7-16(11-24(33)34)17-3-6-23(30-13-17)25(26,27)28/h3-7,10-13H,2,8-9,14-15H2,1H3 |
| InChIKey | ICJLOHOMPVLYAU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.38 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|