C22H21N5O — CID 90292440
5-(5-methyl-2-pyridinyl)-2-(5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-7-yl)pyridazin-3-one (PubChem CID 90292440) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is 5-(5-methyl-2-pyridinyl)-2-(5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-7-yl)pyridazin-3-one.
| Compound Name | 5-(5-methyl-2-pyridinyl)-2-(5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-7-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 90292440 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 5-(5-methyl-2-pyridinyl)-2-(5-methyl-1,2,3,4-tetrahydropyrido[4,3-b]indol-7-yl)pyridazin-3-one |
| SMILES | Cc1ccc(-c2cnn(-c3ccc4c5c(n(C)c4c3)CCNC5)c(=O)c2)nc1 |
| InChI | InChI=1S/C22H21N5O/c1-14-3-6-19(24-11-14)15-9-22(28)27(25-12-15)16-4-5-17-18-13-23-8-7-20(18)26(2)21(17)10-16/h3-6,9-12,23H,7-8,13H2,1-2H3 |
| InChIKey | OBVRPEUUIXFRHV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|