C15H26N2O4 — CID 67976605
1-O-tert-butyl 2-O-cyclopentyl piperazine-1,2-dicarboxylate (PubChem CID 67976605) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-cyclopentyl piperazine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-cyclopentyl piperazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67976605 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-cyclopentyl piperazine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1C(=O)OC1CCCC1 |
| InChI | InChI=1S/C15H26N2O4/c1-15(2,3)21-14(19)17-9-8-16-10-12(17)13(18)20-11-6-4-5-7-11/h11-12,16H,4-10H2,1-3H3 |
| InChIKey | VKZZFLSPFYBSNX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |