C11H23N3O4 — CID 154966146
azane;1-O-tert-butyl 2-O-methyl piperazine-1,2-dicarboxylate (PubChem CID 154966146) has the molecular formula C11H23N3O4 and a molecular weight of 261.32 g/mol. Its IUPAC name is azane;1-O-tert-butyl 2-O-methyl piperazine-1,2-dicarboxylate.
| Compound Name | azane;1-O-tert-butyl 2-O-methyl piperazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 154966146 |
| Molecular Formula | C11H23N3O4 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | azane;1-O-tert-butyl 2-O-methyl piperazine-1,2-dicarboxylate |
| SMILES | COC(=O)C1CNCCN1C(=O)OC(C)(C)C.N |
| InChI | InChI=1S/C11H20N2O4.H3N/c1-11(2,3)17-10(15)13-6-5-12-7-8(13)9(14)16-4;/h8,12H,5-7H2,1-4H3;1H3 |
| InChIKey | DWXYWPLHYDHQMU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 102.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |