C10H19N3O3 — CID 154651315
methyl (2S)-1-(2-amino-2-methylpropanoyl)piperazine-2-carboxylate (PubChem CID 154651315) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is methyl (2S)-1-(2-amino-2-methylpropanoyl)piperazine-2-carboxylate.
| Compound Name | methyl (2S)-1-(2-amino-2-methylpropanoyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 154651315 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | methyl (2S)-1-(2-amino-2-methylpropanoyl)piperazine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CNCCN1C(=O)C(C)(C)N |
| InChI | InChI=1S/C10H19N3O3/c1-10(2,11)9(15)13-5-4-12-6-7(13)8(14)16-3/h7,12H,4-6,11H2,1-3H3/t7-/m0/s1 |
| InChIKey | PESHQGIGGRGZOU-ZETCQYMHSA-N |
| XLogP | -1.30 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |