C28H36F3N3O4Si — CID 67977246
methyl 2,2-dimethyl-3-[4-[4-methyl-5-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]propanoate (PubChem CID 67977246) has the molecular formula C28H36F3N3O4Si and a molecular weight of 563.69 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[4-[4-methyl-5-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]propanoate.
| Compound Name | methyl 2,2-dimethyl-3-[4-[4-methyl-5-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 67977246 |
| Molecular Formula | C28H36F3N3O4Si |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | methyl 2,2-dimethyl-3-[4-[4-methyl-5-[4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenoxy]propanoate |
| SMILES | COC(=O)C(C)(C)COc1ccc(-c2cc(C)c(-c3nc(C(F)(F)F)cn3COCC[Si](C)(C)C)cn2)cc1 |
| InChI | InChI=1S/C28H36F3N3O4Si/c1-19-14-23(20-8-10-21(11-9-20)38-17-27(2,3)26(35)36-4)32-15-22(19)25-33-24(28(29,30)31)16-34(25)18-37-12-13-39(5,6)7/h8-11,14-16H,12-13,17-18H2,1-7H3 |
| InChIKey | SILOCHWXHBZTJQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|