C24H27N3O4S — CID 67977497
methyl N-benzyl-N-[3-[[2-phenyl-1-(1,3-thiazol-5-yl)ethoxy]carbonylamino]propyl]carbamate (PubChem CID 67977497) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is methyl N-benzyl-N-[3-[[2-phenyl-1-(1,3-thiazol-5-yl)ethoxy]carbonylamino]propyl]carbamate.
| Compound Name | methyl N-benzyl-N-[3-[[2-phenyl-1-(1,3-thiazol-5-yl)ethoxy]carbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 67977497 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | methyl N-benzyl-N-[3-[[2-phenyl-1-(1,3-thiazol-5-yl)ethoxy]carbonylamino]propyl]carbamate |
| SMILES | COC(=O)N(CCCNC(=O)OC(Cc1ccccc1)c1cncs1)Cc1ccccc1 |
| InChI | InChI=1S/C24H27N3O4S/c1-30-24(29)27(17-20-11-6-3-7-12-20)14-8-13-26-23(28)31-21(22-16-25-18-32-22)15-19-9-4-2-5-10-19/h2-7,9-12,16,18,21H,8,13-15,17H2,1H3,(H,26,28) |
| InChIKey | MSHYXDPUOJFREL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|