C15H21NO3 — CID 67978623
N-[3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]acetamide (PubChem CID 67978623) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-[3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]acetamide.
| Compound Name | N-[3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 67978623 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-[3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(C2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C15H21NO3/c1-10(17)16-12-8-6-7-11(9-12)13-18-14(2,3)15(4,5)19-13/h6-9,13H,1-5H3,(H,16,17) |
| InChIKey | QQVJDKOMYYZKMX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |