About (4-aminophenyl) 2-carbamoyloxyacetate
(4-aminophenyl) 2-carbamoyloxyacetate (PubChem CID 67980081) has the molecular formula C9H10N2O4
and a molecular weight of 210.19 g/mol. Its IUPAC name is (4-aminophenyl) 2-carbamoyloxyacetate.
Molecular Properties
| Compound Name | (4-aminophenyl) 2-carbamoyloxyacetate |
| PubChem CID | 67980081 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (4-aminophenyl) 2-carbamoyloxyacetate |
| SMILES | NC(=O)OCC(=O)Oc1ccc(N)cc1 |
| InChI | InChI=1S/C9H10N2O4/c10-6-1-3-7(4-2-6)15-8(12)5-14-9(11)13/h1-4H,5,10H2,(H2,11,13) |
| InChIKey | MOQOUNSVTCWPHC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl) 2-carbamoyloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl) 2-carbamoyloxyacetate?
The IUPAC name of (4-aminophenyl) 2-carbamoyloxyacetate (CID 67980081) is (4-aminophenyl) 2-carbamoyloxyacetate.
What is the SMILES notation for (4-aminophenyl) 2-carbamoyloxyacetate?
The canonical SMILES for (4-aminophenyl) 2-carbamoyloxyacetate is NC(=O)OCC(=O)Oc1ccc(N)cc1.
What is the InChIKey of (4-aminophenyl) 2-carbamoyloxyacetate?
The InChIKey is MOQOUNSVTCWPHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4/c10-6-1-3-7(4-2-6)15-8(12)5-14-9(11)13/h1-4H,5,10H2,(H2,11,13).
What are the key properties of (4-aminophenyl) 2-carbamoyloxyacetate?
(4-aminophenyl) 2-carbamoyloxyacetate has a molecular weight of 210.19 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl) 2-carbamoyloxyacetate is sourced from PubChem (CID 67980081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).