About bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate
bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate (PubChem CID 139902600) has the molecular formula C22H22O9
and a molecular weight of 430.41 g/mol. Its IUPAC name is bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate.
Molecular Properties
| Compound Name | bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate |
| PubChem CID | 139902600 |
| Molecular Formula | C22H22O9 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate |
| SMILES | Cc1ccc(OC(=O)COC(=O)CC(O)C(=O)OCC(=O)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H22O9/c1-14-3-7-16(8-4-14)30-20(25)12-28-19(24)11-18(23)22(27)29-13-21(26)31-17-9-5-15(2)6-10-17/h3-10,18,23H,11-13H2,1-2H3 |
| InChIKey | UXCLYARKBPDSQJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate?
The IUPAC name of bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate (CID 139902600) is bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate.
What is the SMILES notation for bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate?
The canonical SMILES for bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate is Cc1ccc(OC(=O)COC(=O)CC(O)C(=O)OCC(=O)Oc2ccc(C)cc2)cc1.
What is the InChIKey of bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate?
The InChIKey is UXCLYARKBPDSQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O9/c1-14-3-7-16(8-4-14)30-20(25)12-28-19(24)11-18(23)22(27)29-13-21(26)31-17-9-5-15(2)6-10-17/h3-10,18,23H,11-13H2,1-2H3.
What are the key properties of bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate?
bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate has a molecular weight of 430.41 g/mol, XLogP of 1.65, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(4-methylphenoxy)-2-oxoethyl] 2-hydroxybutanedioate is sourced from PubChem (CID 139902600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).