C19H16ClNO4 — CID 67982164
2-[1-[(4-chlorophenyl)methyl]-6-methoxy-2-methylindol-3-yl]-2-oxoacetic acid (PubChem CID 67982164) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]-6-methoxy-2-methylindol-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]-6-methoxy-2-methylindol-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 67982164 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]-6-methoxy-2-methylindol-3-yl]-2-oxoacetic acid |
| SMILES | COc1ccc2c(C(=O)C(=O)O)c(C)n(Cc3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C19H16ClNO4/c1-11-17(18(22)19(23)24)15-8-7-14(25-2)9-16(15)21(11)10-12-3-5-13(20)6-4-12/h3-9H,10H2,1-2H3,(H,23,24) |
| InChIKey | UBRAIBJMAQWHRI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|