C27H18Br2N2 — CID 67984515
2-(3,5-dibromophenyl)-4-(4-methylphenyl)-6-naphthalen-2-ylpyrimidine (PubChem CID 67984515) has the molecular formula C27H18Br2N2 and a molecular weight of 530.26 g/mol. Its IUPAC name is 2-(3,5-dibromophenyl)-4-(4-methylphenyl)-6-naphthalen-2-ylpyrimidine.
| Compound Name | 2-(3,5-dibromophenyl)-4-(4-methylphenyl)-6-naphthalen-2-ylpyrimidine |
|---|---|
| PubChem CID | 67984515 |
| Molecular Formula | C27H18Br2N2 |
| Molecular Weight | 530.26 g/mol |
| Exact Mass | 527.98 |
| IUPAC Name | 2-(3,5-dibromophenyl)-4-(4-methylphenyl)-6-naphthalen-2-ylpyrimidine |
| SMILES | Cc1ccc(-c2cc(-c3ccc4ccccc4c3)nc(-c3cc(Br)cc(Br)c3)n2)cc1 |
| InChI | InChI=1S/C27H18Br2N2/c1-17-6-8-19(9-7-17)25-16-26(21-11-10-18-4-2-3-5-20(18)12-21)31-27(30-25)22-13-23(28)15-24(29)14-22/h2-16H,1H3 |
| InChIKey | GHVOJIDMPHEVJH-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.26 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |