C17H18FN3O4 — CID 67987037
N-[[(14S,15S)-8-fluoro-6-methyl-5,12-dioxo-13-oxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-trien-14-yl]methyl]acetamide (PubChem CID 67987037) has the molecular formula C17H18FN3O4 and a molecular weight of 347.35 g/mol. Its IUPAC name is N-[[(14S,15S)-8-fluoro-6-methyl-5,12-dioxo-13-oxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-trien-14-yl]methyl]acetamide.
| Compound Name | N-[[(14S,15S)-8-fluoro-6-methyl-5,12-dioxo-13-oxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-trien-14-yl]methyl]acetamide |
|---|---|
| PubChem CID | 67987037 |
| Molecular Formula | C17H18FN3O4 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[[(14S,15S)-8-fluoro-6-methyl-5,12-dioxo-13-oxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-trien-14-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@@H]1OC(=O)N2c3cc(F)c4c(c3C[C@@H]12)CCC(=O)N4C |
| InChI | InChI=1S/C17H18FN3O4/c1-8(22)19-7-14-13-5-10-9-3-4-15(23)20(2)16(9)11(18)6-12(10)21(13)17(24)25-14/h6,13-14H,3-5,7H2,1-2H3,(H,19,22)/t13-,14-/m0/s1 |
| InChIKey | GFFNOPYXLVGIND-KBPBESRZSA-N |
| XLogP | 1.12 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |