C16H14F3N3O4 — CID 67987051
N-[[(13S,14S)-3,3,7-trifluoro-5-methyl-4,11-dioxo-12-oxa-5,10-diazatetracyclo[7.6.0.02,6.010,14]pentadeca-1,6,8-trien-13-yl]methyl]acetamide (PubChem CID 67987051) has the molecular formula C16H14F3N3O4 and a molecular weight of 369.30 g/mol. Its IUPAC name is N-[[(13S,14S)-3,3,7-trifluoro-5-methyl-4,11-dioxo-12-oxa-5,10-diazatetracyclo[7.6.0.02,6.010,14]pentadeca-1,6,8-trien-13-yl]methyl]acetamide.
| Compound Name | N-[[(13S,14S)-3,3,7-trifluoro-5-methyl-4,11-dioxo-12-oxa-5,10-diazatetracyclo[7.6.0.02,6.010,14]pentadeca-1,6,8-trien-13-yl]methyl]acetamide |
|---|---|
| PubChem CID | 67987051 |
| Molecular Formula | C16H14F3N3O4 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-[[(13S,14S)-3,3,7-trifluoro-5-methyl-4,11-dioxo-12-oxa-5,10-diazatetracyclo[7.6.0.02,6.010,14]pentadeca-1,6,8-trien-13-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@@H]1OC(=O)N2c3cc(F)c4c(c3C[C@@H]12)C(F)(F)C(=O)N4C |
| InChI | InChI=1S/C16H14F3N3O4/c1-6(23)20-5-11-10-3-7-9(22(10)15(25)26-11)4-8(17)13-12(7)16(18,19)14(24)21(13)2/h4,10-11H,3,5H2,1-2H3,(H,20,23)/t10-,11-/m0/s1 |
| InChIKey | YWQNNFUZYGFFCG-QWRGUYRKSA-N |
| XLogP | 1.28 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |