C17H14F3N5O3 — CID 67987039
(14S,15S)-3,3,8-trifluoro-6-methyl-14-(triazol-1-ylmethyl)-13-oxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-triene-5,12-dione (PubChem CID 67987039) has the molecular formula C17H14F3N5O3 and a molecular weight of 393.33 g/mol. Its IUPAC name is (14S,15S)-3,3,8-trifluoro-6-methyl-14-(triazol-1-ylmethyl)-13-oxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-triene-5,12-dione.
| Compound Name | (14S,15S)-3,3,8-trifluoro-6-methyl-14-(triazol-1-ylmethyl)-13-oxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-triene-5,12-dione |
|---|---|
| PubChem CID | 67987039 |
| Molecular Formula | C17H14F3N5O3 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (14S,15S)-3,3,8-trifluoro-6-methyl-14-(triazol-1-ylmethyl)-13-oxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-triene-5,12-dione |
| SMILES | CN1C(=O)CC(F)(F)c2c3c(cc(F)c21)N1C(=O)O[C@@H](Cn2ccnn2)[C@@H]1C3 |
| InChI | InChI=1S/C17H14F3N5O3/c1-23-13(26)6-17(19,20)14-8-4-11-12(7-24-3-2-21-22-24)28-16(27)25(11)10(8)5-9(18)15(14)23/h2-3,5,11-12H,4,6-7H2,1H3/t11-,12-/m0/s1 |
| InChIKey | JUIDCEPOONOFMP-RYUDHWBXSA-N |
| XLogP | 1.83 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |