C16H14FN5O4 — CID 67987045
(14S,15S)-8-fluoro-6-methyl-14-(triazol-1-ylmethyl)-3,13-dioxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-triene-5,12-dione (PubChem CID 67987045) has the molecular formula C16H14FN5O4 and a molecular weight of 359.32 g/mol. Its IUPAC name is (14S,15S)-8-fluoro-6-methyl-14-(triazol-1-ylmethyl)-3,13-dioxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-triene-5,12-dione.
| Compound Name | (14S,15S)-8-fluoro-6-methyl-14-(triazol-1-ylmethyl)-3,13-dioxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-triene-5,12-dione |
|---|---|
| PubChem CID | 67987045 |
| Molecular Formula | C16H14FN5O4 |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | (14S,15S)-8-fluoro-6-methyl-14-(triazol-1-ylmethyl)-3,13-dioxa-6,11-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-1,7,9-triene-5,12-dione |
| SMILES | CN1C(=O)COc2c3c(cc(F)c21)N1C(=O)O[C@@H](Cn2ccnn2)[C@@H]1C3 |
| InChI | InChI=1S/C16H14FN5O4/c1-20-13(23)7-25-15-8-4-11-12(6-21-3-2-18-19-21)26-16(24)22(11)10(8)5-9(17)14(15)20/h2-3,5,11-12H,4,6-7H2,1H3/t11-,12-/m0/s1 |
| InChIKey | BUDGKNAYSHLSMY-RYUDHWBXSA-N |
| XLogP | 0.72 |
| TPSA | 89.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |