C30H40N2O2 — CID 67987980
1-[1-[[4-[2-[di(propan-2-yl)amino]ethoxy]phenyl]methyl]naphthalen-2-yl]piperidin-4-ol (PubChem CID 67987980) has the molecular formula C30H40N2O2 and a molecular weight of 460.66 g/mol. Its IUPAC name is 1-[1-[[4-[2-[di(propan-2-yl)amino]ethoxy]phenyl]methyl]naphthalen-2-yl]piperidin-4-ol.
| Compound Name | 1-[1-[[4-[2-[di(propan-2-yl)amino]ethoxy]phenyl]methyl]naphthalen-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 67987980 |
| Molecular Formula | C30H40N2O2 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | 1-[1-[[4-[2-[di(propan-2-yl)amino]ethoxy]phenyl]methyl]naphthalen-2-yl]piperidin-4-ol |
| SMILES | CC(C)N(CCOc1ccc(Cc2c(N3CCC(O)CC3)ccc3ccccc23)cc1)C(C)C |
| InChI | InChI=1S/C30H40N2O2/c1-22(2)32(23(3)4)19-20-34-27-12-9-24(10-13-27)21-29-28-8-6-5-7-25(28)11-14-30(29)31-17-15-26(33)16-18-31/h5-14,22-23,26,33H,15-21H2,1-4H3 |
| InChIKey | JAOJIDWNIOGJJA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |