C28H37NO3 — CID 57388173
1-[1-[[4-[2-(dipropylamino)ethoxy]phenyl]methyl]naphthalen-2-yl]oxypropan-2-ol (PubChem CID 57388173) has the molecular formula C28H37NO3 and a molecular weight of 435.61 g/mol. Its IUPAC name is 1-[1-[[4-[2-(dipropylamino)ethoxy]phenyl]methyl]naphthalen-2-yl]oxypropan-2-ol.
| Compound Name | 1-[1-[[4-[2-(dipropylamino)ethoxy]phenyl]methyl]naphthalen-2-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 57388173 |
| Molecular Formula | C28H37NO3 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | 1-[1-[[4-[2-(dipropylamino)ethoxy]phenyl]methyl]naphthalen-2-yl]oxypropan-2-ol |
| SMILES | CCCN(CCC)CCOc1ccc(Cc2c(OCC(C)O)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H37NO3/c1-4-16-29(17-5-2)18-19-31-25-13-10-23(11-14-25)20-27-26-9-7-6-8-24(26)12-15-28(27)32-21-22(3)30/h6-15,22,30H,4-5,16-21H2,1-3H3 |
| InChIKey | NBMLMDSMRAWICM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |