C26H33NO4 — CID 57388462
5-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-6-(3-hydroxypropoxy)naphthalen-2-ol (PubChem CID 57388462) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is 5-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-6-(3-hydroxypropoxy)naphthalen-2-ol.
| Compound Name | 5-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-6-(3-hydroxypropoxy)naphthalen-2-ol |
|---|---|
| PubChem CID | 57388462 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 5-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-6-(3-hydroxypropoxy)naphthalen-2-ol |
| SMILES | CCN(CC)CCOc1ccc(Cc2c(OCCCO)ccc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C26H33NO4/c1-3-27(4-2)14-17-30-23-10-6-20(7-11-23)18-25-24-12-9-22(29)19-21(24)8-13-26(25)31-16-5-15-28/h6-13,19,28-29H,3-5,14-18H2,1-2H3 |
| InChIKey | KIJRELWAWUMOLC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|