C17H15FN4O4 — CID 67988781
(13S,14S)-7-fluoro-5-methyl-13-[(1,2-oxazol-3-ylamino)methyl]-12-oxa-5,10-diazatetracyclo[7.6.0.02,6.010,14]pentadeca-1,6,8-triene-4,11-dione (PubChem CID 67988781) has the molecular formula C17H15FN4O4 and a molecular weight of 358.33 g/mol. Its IUPAC name is (13S,14S)-7-fluoro-5-methyl-13-[(1,2-oxazol-3-ylamino)methyl]-12-oxa-5,10-diazatetracyclo[7.6.0.02,6.010,14]pentadeca-1,6,8-triene-4,11-dione.
| Compound Name | (13S,14S)-7-fluoro-5-methyl-13-[(1,2-oxazol-3-ylamino)methyl]-12-oxa-5,10-diazatetracyclo[7.6.0.02,6.010,14]pentadeca-1,6,8-triene-4,11-dione |
|---|---|
| PubChem CID | 67988781 |
| Molecular Formula | C17H15FN4O4 |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (13S,14S)-7-fluoro-5-methyl-13-[(1,2-oxazol-3-ylamino)methyl]-12-oxa-5,10-diazatetracyclo[7.6.0.02,6.010,14]pentadeca-1,6,8-triene-4,11-dione |
| SMILES | CN1C(=O)Cc2c3c(cc(F)c21)N1C(=O)O[C@@H](CNc2ccon2)[C@@H]1C3 |
| InChI | InChI=1S/C17H15FN4O4/c1-21-15(23)5-9-8-4-12-13(7-19-14-2-3-25-20-14)26-17(24)22(12)11(8)6-10(18)16(9)21/h2-3,6,12-13H,4-5,7H2,1H3,(H,19,20)/t12-,13-/m0/s1 |
| InChIKey | FPDJDHMZYWMPKB-STQMWFEESA-N |
| XLogP | 1.69 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |