C24H22N4O — CID 67990345
(2S,7R)-2,6,6-trimethyl-5-oxo-14-phenyl-12,16,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),3,11,13,15-pentaene-4-carbonitrile (PubChem CID 67990345) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is (2S,7R)-2,6,6-trimethyl-5-oxo-14-phenyl-12,16,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),3,11,13,15-pentaene-4-carbonitrile.
| Compound Name | (2S,7R)-2,6,6-trimethyl-5-oxo-14-phenyl-12,16,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),3,11,13,15-pentaene-4-carbonitrile |
|---|---|
| PubChem CID | 67990345 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (2S,7R)-2,6,6-trimethyl-5-oxo-14-phenyl-12,16,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),3,11,13,15-pentaene-4-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@]2(C)c3c(cnc4c(-c5ccccc5)cnn34)CC[C@@H]12 |
| InChI | InChI=1S/C24H22N4O/c1-23(2)19-10-9-16-13-26-22-18(15-7-5-4-6-8-15)14-27-28(22)20(16)24(19,3)11-17(12-25)21(23)29/h4-8,11,13-14,19H,9-10H2,1-3H3/t19-,24-/m0/s1 |
| InChIKey | GADIZBIEZMICTC-CYFREDJKSA-N |
| XLogP | 4.28 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |