About 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine
1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine (PubChem CID 67990664) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine |
| PubChem CID | 67990664 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine |
| SMILES | CC(C)CC(N)CNCCCC1=CC=CCC1 |
| InChI | InChI=1S/C15H28N2/c1-13(2)11-15(16)12-17-10-6-9-14-7-4-3-5-8-14/h3-4,7,13,15,17H,5-6,8-12,16H2,1-2H3 |
| InChIKey | NMMZQNYHKXPHOP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine?
The IUPAC name of 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine (CID 67990664) is 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine.
What is the SMILES notation for 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine?
The canonical SMILES for 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine is CC(C)CC(N)CNCCCC1=CC=CCC1.
What is the InChIKey of 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine?
The InChIKey is NMMZQNYHKXPHOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2/c1-13(2)11-15(16)12-17-10-6-9-14-7-4-3-5-8-14/h3-4,7,13,15,17H,5-6,8-12,16H2,1-2H3.
What are the key properties of 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine?
1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine has a molecular weight of 236.40 g/mol, XLogP of 3.01, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methylpentane-1,2-diamine is sourced from PubChem (CID 67990664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).